CAS 1133712-38-5 appears in our catalog under these names: Modafinil d5(controlled substance), Modafinil-d5, Modafinil-d5 (Mixture of Diastereomers), >95% (HPLC). Offered by: Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg.
2-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]sulfinylacetamide (CAS 1133712-38-5) is a chemical compound with the molecular formula C15H15NO2S and a molecular weight of 278.38 g/mol. IUPAC name: 2-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]sulfinylacetamide. InChIKey: YFGHCGITMMYXAQ-DYVTXVBDSA-N.
| Molecular formula | C15H15NO2S |
|---|---|
| Molecular weight | 278.38 g/mol |
| IUPAC name | 2-[(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]sulfinylacetamide |
| InChIKey | YFGHCGITMMYXAQ-DYVTXVBDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=CC=CC=C2)S(=O)CC(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)