CAS 1219804-30-4 appears in our catalog under these names: (R)-Modafinil-d10, (S)-Modafinil-d10, (±)-Modafinil-d10 (diphenyl-d10), 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 1mg, 0,05g.
2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide (CAS 1219804-30-4) is a chemical compound with the molecular formula C15H15NO2S and a molecular weight of 283.41 g/mol. IUPAC name: 2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide. InChIKey: YFGHCGITMMYXAQ-LHNTUAQVSA-N.
| Molecular formula | C15H15NO2S |
|---|---|
| Molecular weight | 283.41 g/mol |
| IUPAC name | 2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide |
| InChIKey | YFGHCGITMMYXAQ-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])S(=O)CC(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)