Products 1134-87-8
CAS 1134-87-8 appears in our catalog under these names: 3-Benzyl-2,4-pentanedione, 95%, 3-Benzylpentane-2,4-dione 98%, 3-benzyl-2,4-pentanedione, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 250mg, 10g, 5g, 1g, 100mg.
3-benzylpentane-2,4-dione (CAS 1134-87-8) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 3-benzylpentane-2,4-dione. InChIKey: WAJQTBOWJRUOOO-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 3-benzylpentane-2,4-dione |
| InChIKey | WAJQTBOWJRUOOO-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CC1=CC=CC=C1)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
3-Benzyl-2,4-pentanedione, 2,4-Pentanedione, 3-benzyl-, 2,4-Pentanedione, 3-benzyl-(8CI), WAJQTBOWJRUOOO-UHFFFAOYSA-N, 3-benzylpentane-2,4-dione, 2,4-Pentanedione, 3-(phenylmethyl)-, 2,4-Pentandedione, 3-(phenylmethyl), 3-(phenylmethyl)pentane-2,4-dione, 2,4-Pentanedione, 3-benzyl- (8CI), 2, 3-benzyl-