Products 1134163-29-3
CAS 1134163-29-3 appears in our catalog under these names: Pioglitazone-d4, (±)-Pioglitazone-d4 (phenyl-d4), >95% (HPLC), (±)-Pioglitazone-d4 (phenyl-d4), 98 atom % D, min 98% Chemical Purity, Pioglitazone D4, Pioglitazone-d4, 99.34%. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 10mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
5-[[2,3,5,6-tetradeuterio-4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 1134163-29-3) is a chemical compound with the molecular formula C19H20N2O3S and a molecular weight of 360.5 g/mol. IUPAC name: 5-[[2,3,5,6-tetradeuterio-4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: HYAFETHFCAUJAY-YBNXMSKUSA-N.
| Molecular formula | C19H20N2O3S |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | 5-[[2,3,5,6-tetradeuterio-4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | HYAFETHFCAUJAY-YBNXMSKUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CC2C(=O)NC(=O)S2)[2H])[2H])OCCC3=NC=C(C=C3)CC)[2H] |
Computed by PubChem (NCBI)