CAS 197904-84-0 appears in our catalog under these names: Apricoxib, >95% (HPLC), Apricoxib. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
4-[2-(4-ethoxyphenyl)-4-methylpyrrol-1-yl]benzenesulfonamide (CAS 197904-84-0) is a chemical compound with the molecular formula C19H20N2O3S and a molecular weight of 356.4 g/mol. IUPAC name: 4-[2-(4-ethoxyphenyl)-4-methylpyrrol-1-yl]benzenesulfonamide. InChIKey: JTMITOKKUMVWRT-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O3S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 4-[2-(4-ethoxyphenyl)-4-methylpyrrol-1-yl]benzenesulfonamide |
| InChIKey | JTMITOKKUMVWRT-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=CC(=CN2C3=CC=C(C=C3)S(=O)(=O)N)C |
Computed by PubChem (NCBI)