CAS 1134203-13-6 is the registry number for (5Z)-5-(p-Nitrobenzylidene)rhodanine. Offered by: TRC. Available pack sizes: 10g, 2,5g, 5g.
(5Z)-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1134203-13-6) is a chemical compound with the molecular formula C10H6N2O3S2 and a molecular weight of 266.3 g/mol. IUPAC name: (5Z)-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: FRWNAQDBODEVAL-YVMONPNESA-N.
| Molecular formula | C10H6N2O3S2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | (5Z)-5-[(4-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | FRWNAQDBODEVAL-YVMONPNESA-N |
| SMILES | C1=CC(=CC=C1/C=C\2/C(=O)NC(=S)S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)