CAS 6308-22-1 appears in our catalog under these names: (5E)-2-Mercapto-5-(2-nitrobenzylidene)-1,3-thiazol-4(5h)-one, 95%, AKOS B018304/ 99.19% (existing batch purity), AKOS B018304, (5E)-2-Mercapto-5-(2-nitrobenzylidene)-1,3-thiazol-4(5h)-one, ≥98%, ≥98%, AKOS B018304, 99.37%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(5E)-5-[(2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 6308-22-1) is a chemical compound with the molecular formula C10H6N2O3S2 and a molecular weight of 266.3 g/mol. IUPAC name: (5E)-5-[(2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: CTTRUEBEEFZQBL-VMPITWQZSA-N.
| Molecular formula | C10H6N2O3S2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | (5E)-5-[(2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | CTTRUEBEEFZQBL-VMPITWQZSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/2\C(=O)NC(=S)S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)