CAS 1134331-76-2 is the registry number for 2,6-Bis(4-bromophenyl)-4,4'-bipyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis(4-bromophenyl)-4-pyridin-4-ylpyridine (CAS 1134331-76-2) is a chemical compound with the molecular formula C22H14Br2N2 and a molecular weight of 466.2 g/mol. IUPAC name: 2,6-bis(4-bromophenyl)-4-pyridin-4-ylpyridine. InChIKey: UAXVVHVKXIRCIR-UHFFFAOYSA-N.
| Molecular formula | C22H14Br2N2 |
|---|---|
| Molecular weight | 466.2 g/mol |
| IUPAC name | 2,6-bis(4-bromophenyl)-4-pyridin-4-ylpyridine |
| InChIKey | UAXVVHVKXIRCIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=N2)C3=CC=C(C=C3)Br)C4=CC=NC=C4)Br |
Computed by PubChem (NCBI)