CAS 607740-08-9 appears in our catalog under these names: 4-(3,5-Dibromophenyl)-2,6-diphenylpyrimidine, 95%, 4–(3,5–Dibromophenyl)–2,6–diphenylpyrimidine, 4-(3,5-Dibromophenyl)-2,6-diphenylpyrimidine, >98.0%(HPLC)(N), 4-(3,5-Dibromophenyl)-2,6-diphenylpyrimidine, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 200mg, 100mg, 250mg.
4-(3,5-dibromophenyl)-2,6-diphenylpyrimidine (CAS 607740-08-9) is a chemical compound with the molecular formula C22H14Br2N2 and a molecular weight of 466.2 g/mol. IUPAC name: 4-(3,5-dibromophenyl)-2,6-diphenylpyrimidine. InChIKey: DLXBSWIBLRUGFU-UHFFFAOYSA-N.
| Molecular formula | C22H14Br2N2 |
|---|---|
| Molecular weight | 466.2 g/mol |
| IUPAC name | 4-(3,5-dibromophenyl)-2,6-diphenylpyrimidine |
| InChIKey | DLXBSWIBLRUGFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC(=CC(=C4)Br)Br |
Computed by PubChem (NCBI)