Products 1134334-69-2
CAS 1134334-69-2 is the registry number for 3-Bromo-2-methyl-1-(1,2,5-trimethyl-1H-indol-3-yl)propan-1-one. Offered by: Biosynth. Available pack sizes: 5000mg.
3-bromo-2-methyl-1-(1,2,5-trimethylindol-3-yl)propan-1-one (CAS 1134334-69-2) is a chemical compound with the molecular formula C15H18BrNO and a molecular weight of 308.21 g/mol. IUPAC name: 3-bromo-2-methyl-1-(1,2,5-trimethylindol-3-yl)propan-1-one. InChIKey: WWWXRPAUPDMJEM-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO |
|---|---|
| Molecular weight | 308.21 g/mol |
| IUPAC name | 3-bromo-2-methyl-1-(1,2,5-trimethylindol-3-yl)propan-1-one |
| InChIKey | WWWXRPAUPDMJEM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=C2C(=O)C(C)CBr)C)C |
Computed by PubChem (NCBI)