CAS 1383985-58-7 is the registry number for 6'-Bromo-4-methoxyspiro[cyclohexane-1,2'-inden]-1'(3'H)-imine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-imine (CAS 1383985-58-7) is a chemical compound with the molecular formula C15H18BrNO and a molecular weight of 308.21 g/mol. IUPAC name: 6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-imine. InChIKey: FEXLRNLRZGRQAV-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO |
|---|---|
| Molecular weight | 308.21 g/mol |
| IUPAC name | 6-bromo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-imine |
| InChIKey | FEXLRNLRZGRQAV-UHFFFAOYSA-N |
| SMILES | COC1CCC2(CC1)CC3=C(C2=N)C=C(C=C3)Br |
Computed by PubChem (NCBI)