CAS 113457-31-1 appears in our catalog under these names: 4-(2,4-Dichloro-benzyloxy)-3-methoxy-benzoic acid, 95%, 4-((2,4-Dichlorophenyl)methoxy)-3-methoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzoic acid (CAS 113457-31-1) is a chemical compound with the molecular formula C15H12Cl2O4 and a molecular weight of 327.2 g/mol. IUPAC name: 4-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzoic acid. InChIKey: NVHDYMQROKRTPK-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O4 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 4-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzoic acid |
| InChIKey | NVHDYMQROKRTPK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)OCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)