CAS 872197-30-3 appears in our catalog under these names: 2-[(2,4-Dichlorobenzyl)oxy]-3-methoxybenzoic acid, 95%, 2-((2,4-Dichlorobenzyl)oxy)-3-methoxybenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzoic acid (CAS 872197-30-3) is a chemical compound with the molecular formula C15H12Cl2O4 and a molecular weight of 327.2 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzoic acid. InChIKey: JLKDMNKYHBKWCV-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O4 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzoic acid |
| InChIKey | JLKDMNKYHBKWCV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1OCC2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)