CAS 113457-36-6 appears in our catalog under these names: 4-[(4-Chlorobenzyl)oxy]-3-methoxybenzoic acid, 95%, 4-((4-Chlorobenzyl)oxy)-3-methoxybenzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-[(4-chlorophenyl)methoxy]-3-methoxybenzoic acid (CAS 113457-36-6) is a chemical compound with the molecular formula C15H13ClO4 and a molecular weight of 292.71 g/mol. IUPAC name: 4-[(4-chlorophenyl)methoxy]-3-methoxybenzoic acid. InChIKey: YMRCVEFBDPOBEK-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO4 |
|---|---|
| Molecular weight | 292.71 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methoxy]-3-methoxybenzoic acid |
| InChIKey | YMRCVEFBDPOBEK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)OCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)