Products 938251-64-0

CAS 938251-64-0 is the registry number for 2-[(3-Chlorobenzyl)oxy]-3-methoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(3-chlorophenyl)methoxy]-3-methoxybenzoic acid (CAS 938251-64-0) is a chemical compound with the molecular formula C15H13ClO4 and a molecular weight of 292.71 g/mol. IUPAC name: 2-[(3-chlorophenyl)methoxy]-3-methoxybenzoic acid. InChIKey: JXIOGMZHKWYEMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13ClO4
Molecular weight292.71 g/mol
IUPAC name2-[(3-chlorophenyl)methoxy]-3-methoxybenzoic acid
InChIKeyJXIOGMZHKWYEMZ-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1OCC2=CC(=CC=C2)Cl)C(=O)O

Computed by PubChem (NCBI)