CAS 113479-11-1 appears in our catalog under these names: 3-(Benzylamino)-3-methylbutanoic acid, 97%, 3–(Benzylamino)–3–methylbutanoic Acid, 3-(Benzylamino)-3-methylbutanoic Acid, >97%, >97%, 3-(Benzylamino)-3-methylbutanoic acid, >97%, 3-(Benzylamino)-3-methylbutanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 250mg.
3-(benzylamino)-3-methylbutanoic acid (CAS 113479-11-1) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 3-(benzylamino)-3-methylbutanoic acid. InChIKey: DHXNGBMVPJHMBV-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 3-(benzylamino)-3-methylbutanoic acid |
| InChIKey | DHXNGBMVPJHMBV-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)