CAS 113485-56-6 is the registry number for 5-(5-Bromo-2-furyl)-1h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(5-bromofuran-2-yl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 113485-56-6) is a chemical compound with the molecular formula C6H4BrN3OS and a molecular weight of 246.09 g/mol. IUPAC name: 5-(5-bromofuran-2-yl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: ASXLYCYGBJYNSN-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3OS |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 5-(5-bromofuran-2-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | ASXLYCYGBJYNSN-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)