CAS 2650592-34-8 is the registry number for 2-Amino-6-bromothieno[3,2-d]pyrimidin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-bromo-3H-thieno[3,2-d]pyrimidin-4-one (CAS 2650592-34-8) is a chemical compound with the molecular formula C6H4BrN3OS and a molecular weight of 246.09 g/mol. IUPAC name: 2-amino-6-bromo-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: OOXLBKZSXJWHHK-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3OS |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 2-amino-6-bromo-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | OOXLBKZSXJWHHK-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1N=C(NC2=O)N)Br |
Computed by PubChem (NCBI)