Products 1134918-17-4

CAS 1134918-17-4 appears in our catalog under these names: 3,5-Dibromo-4-methoxybenzylamine hydrochloride, (3,5-Dibromo-4-methoxybenzyl)amine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 500mg, 100mg, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3,5-dibromo-4-methoxyphenyl)methanamine;hydrochloride (CAS 1134918-17-4) is a chemical compound with the molecular formula C8H10Br2ClNO and a molecular weight of 331.43 g/mol. IUPAC name: (3,5-dibromo-4-methoxyphenyl)methanamine;hydrochloride. InChIKey: XJJXUHXUJFQELB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10Br2ClNO
Molecular weight331.43 g/mol
IUPAC name(3,5-dibromo-4-methoxyphenyl)methanamine;hydrochloride
InChIKeyXJJXUHXUJFQELB-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1Br)CN)Br.Cl

Computed by PubChem (NCBI)