CAS 2703746-43-2 appears in our catalog under these names: (S)-2-Amino-2-(3,5-dibromophenyl)ethan-1-ol hydrochloride, 95%, (S)-2-Amino-2-(3,5-dibromophenyl)ethan-1-ol hydrochloride, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-2-(3,5-dibromophenyl)ethanol;hydrochloride (CAS 2703746-43-2) is a chemical compound with the molecular formula C8H10Br2ClNO and a molecular weight of 331.43 g/mol. IUPAC name: (2S)-2-amino-2-(3,5-dibromophenyl)ethanol;hydrochloride. InChIKey: ZEVMXBCVAPHWEC-DDWIOCJRSA-N.
| Molecular formula | C8H10Br2ClNO |
|---|---|
| Molecular weight | 331.43 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,5-dibromophenyl)ethanol;hydrochloride |
| InChIKey | ZEVMXBCVAPHWEC-DDWIOCJRSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)