CAS 1135049-14-7 is the registry number for 2,4,6-Piperidinetrione Sodium Salt. Offered by: TRC. Available pack sizes: 10g.
Sodium piperidin-1-ide-2,4,6-trione (CAS 1135049-14-7) is a chemical compound with the molecular formula C5H4NNaO3 and a molecular weight of 149.08 g/mol. IUPAC name: sodium piperidin-1-ide-2,4,6-trione. InChIKey: GXLNBBTXKZHCIK-UHFFFAOYSA-M.
| Molecular formula | C5H4NNaO3 |
|---|---|
| Molecular weight | 149.08 g/mol |
| IUPAC name | sodium piperidin-1-ide-2,4,6-trione |
| InChIKey | GXLNBBTXKZHCIK-UHFFFAOYSA-M |
| SMILES | C1C(=O)CC(=O)[N-]C1=O.[Na+] |
Computed by PubChem (NCBI)