CAS 2137530-82-4 is the registry number for Sodium 4-methyl-1,3-oxazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 4-methyl-1,3-oxazole-2-carboxylate (CAS 2137530-82-4) is a chemical compound with the molecular formula C5H4NNaO3 and a molecular weight of 149.08 g/mol. IUPAC name: sodium 4-methyl-1,3-oxazole-2-carboxylate. InChIKey: ZUCKLOIUTYDZMS-UHFFFAOYSA-M.
| Molecular formula | C5H4NNaO3 |
|---|---|
| Molecular weight | 149.08 g/mol |
| IUPAC name | sodium 4-methyl-1,3-oxazole-2-carboxylate |
| InChIKey | ZUCKLOIUTYDZMS-UHFFFAOYSA-M |
| SMILES | CC1=COC(=N1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)