Products 113512-08-6
CAS 113512-08-6 appears in our catalog under these names: L–Cystine–34S2, L-Cystine-34S2, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 1mg.
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]di(34S)sulfanyl]propanoic acid (CAS 113512-08-6) is a chemical compound with the molecular formula C6H12N2O4S2 and a molecular weight of 244.11 g/mol. IUPAC name: (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]di(34S)sulfanyl]propanoic acid. InChIKey: LEVWYRKDKASIDU-RWTAFAFMSA-N.
| Molecular formula | C6H12N2O4S2 |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]di(34S)sulfanyl]propanoic acid |
| InChIKey | LEVWYRKDKASIDU-RWTAFAFMSA-N |
| SMILES | C([C@@H](C(=O)O)N)[34S][34S]C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)