Products 352431-53-9
CAS 352431-53-9 appears in our catalog under these names: DL-Cystine-2,2',3,3,3',3'-d6, >95% (HPLC), DL-Cystine-2,2',3,3,3',3'-d6, 98 atom % D, min 98% Chemical Purity, DL–Cystine–d6, DL-Cystine-d6, 99.81%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 10 mg, 1 mg.
2-amino-3-[(2-amino-2-carboxy-1,1,2-trideuterioethyl)disulfanyl]-2,3,3-trideuteriopropanoic acid (CAS 352431-53-9) is a chemical compound with the molecular formula C6H12N2O4S2 and a molecular weight of 246.3 g/mol. IUPAC name: 2-amino-3-[(2-amino-2-carboxy-1,1,2-trideuterioethyl)disulfanyl]-2,3,3-trideuteriopropanoic acid. InChIKey: LEVWYRKDKASIDU-UFSLNRCZSA-N.
| Molecular formula | C6H12N2O4S2 |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 2-amino-3-[(2-amino-2-carboxy-1,1,2-trideuterioethyl)disulfanyl]-2,3,3-trideuteriopropanoic acid |
| InChIKey | LEVWYRKDKASIDU-UFSLNRCZSA-N |
| SMILES | [2H]C([2H])(C([2H])(C(=O)O)N)SSC([2H])([2H])C([2H])(C(=O)O)N |
Computed by PubChem (NCBI)