CAS 1135283-34-9 is the registry number for 2-[4-(tert-Butoxycarbonyl)piperazino]-3-chloroisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-chloro-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-4-carboxylic acid (CAS 1135283-34-9) is a chemical compound with the molecular formula C15H20ClN3O4 and a molecular weight of 341.79 g/mol. IUPAC name: 3-chloro-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-4-carboxylic acid. InChIKey: BQEVNJWCIQUOSK-UHFFFAOYSA-N.
| Molecular formula | C15H20ClN3O4 |
|---|---|
| Molecular weight | 341.79 g/mol |
| IUPAC name | 3-chloro-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-4-carboxylic acid |
| InChIKey | BQEVNJWCIQUOSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=CC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)