CAS 193902-80-6 is the registry number for tert-Butyl 4-(2-chloro-4-nitrophenyl)piperazine-1-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
Tert-butyl 4-(2-chloro-4-nitrophenyl)piperazine-1-carboxylate (CAS 193902-80-6) is a chemical compound with the molecular formula C15H20ClN3O4 and a molecular weight of 341.79 g/mol. IUPAC name: tert-butyl 4-(2-chloro-4-nitrophenyl)piperazine-1-carboxylate. InChIKey: HTMRIXVUKSIEPV-UHFFFAOYSA-N.
| Molecular formula | C15H20ClN3O4 |
|---|---|
| Molecular weight | 341.79 g/mol |
| IUPAC name | tert-butyl 4-(2-chloro-4-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | HTMRIXVUKSIEPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)