Products 1135334-50-7
CAS 1135334-50-7 appears in our catalog under these names: Promethazine Impurity 16, Promethazine Impurity 3, Promethazine Sulfoxide N-Oxide HCl, N,N,alpha-Trimethyl-10H-Phenothiazine-10-ethanamine N,5-Dioxide Hydrochloride (1:1), Promethazine Sulphoxide N-Oxide Hydrochloride. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 50mg, 100mg.
N,N-dimethyl-1-(5-oxophenothiazin-10-yl)propan-2-amine oxide;hydrochloride (CAS 1135334-50-7) is a chemical compound with the molecular formula C17H21ClN2O2S and a molecular weight of 352.9 g/mol. IUPAC name: N,N-dimethyl-1-(5-oxophenothiazin-10-yl)propan-2-amine oxide;hydrochloride. InChIKey: DLHPFOSVJVLDLK-UHFFFAOYSA-N.
| Molecular formula | C17H21ClN2O2S |
|---|---|
| Molecular weight | 352.9 g/mol |
| IUPAC name | N,N-dimethyl-1-(5-oxophenothiazin-10-yl)propan-2-amine oxide;hydrochloride |
| InChIKey | DLHPFOSVJVLDLK-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2S(=O)C3=CC=CC=C31)[N+](C)(C)[O-].Cl |
Computed by PubChem (NCBI)