CAS 384815-61-6 is the registry number for (2-[4-(3,4-Dihydroisoquinolin-2(1h)-ylsulfonyl)phenyl]ethyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]ethanamine;hydrochloride (CAS 384815-61-6) is a chemical compound with the molecular formula C17H21ClN2O2S and a molecular weight of 352.9 g/mol. IUPAC name: 2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]ethanamine;hydrochloride. InChIKey: NMZCOVZLKOVPBD-UHFFFAOYSA-N.
| Molecular formula | C17H21ClN2O2S |
|---|---|
| Molecular weight | 352.9 g/mol |
| IUPAC name | 2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]ethanamine;hydrochloride |
| InChIKey | NMZCOVZLKOVPBD-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)S(=O)(=O)C3=CC=C(C=C3)CCN.Cl |
Computed by PubChem (NCBI)