Products 113567-15-0

CAS 113567-15-0 is the registry number for (S)-Dimethyl [1,1'-binaphthalene]-2,2'-dicarboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-(2-methoxycarbonylnaphthalen-1-yl)naphthalene-2-carboxylate (CAS 113567-15-0) is a chemical compound with the molecular formula C24H18O4 and a molecular weight of 370.4 g/mol. IUPAC name: methyl 1-(2-methoxycarbonylnaphthalen-1-yl)naphthalene-2-carboxylate. InChIKey: IIJQXSWPACKCHL-UHFFFAOYSA-N.

Identity
Molecular formulaC24H18O4
Molecular weight370.4 g/mol
IUPAC namemethyl 1-(2-methoxycarbonylnaphthalen-1-yl)naphthalene-2-carboxylate
InChIKeyIIJQXSWPACKCHL-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)C(=O)OC

Computed by PubChem (NCBI)