CAS 85464-88-6 appears in our catalog under these names: [1,1'-Binaphthalene]-2,2'-dicarboxylic acid, dimethyl ester, 95%, dimethyl (1,1'–binaphthalene)–2,2'–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g.
Methyl 1-(2-methoxycarbonylnaphthalen-1-yl)naphthalene-2-carboxylate (CAS 85464-88-6) is a chemical compound with the molecular formula C24H18O4 and a molecular weight of 370.4 g/mol. IUPAC name: methyl 1-(2-methoxycarbonylnaphthalen-1-yl)naphthalene-2-carboxylate. InChIKey: IIJQXSWPACKCHL-UHFFFAOYSA-N.
| Molecular formula | C24H18O4 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | methyl 1-(2-methoxycarbonylnaphthalen-1-yl)naphthalene-2-carboxylate |
| InChIKey | IIJQXSWPACKCHL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)C(=O)OC |
Computed by PubChem (NCBI)