Products 1135694-25-5

CAS 1135694-25-5 is the registry number for 11-(2,3-Dihydroxypropoxy)undecanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

11-(2,3-dihydroxypropoxy)undecanoic acid (CAS 1135694-25-5) is a chemical compound with the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. IUPAC name: 11-(2,3-dihydroxypropoxy)undecanoic acid. InChIKey: ABAGAKRGOFFKAC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H28O5
Molecular weight276.37 g/mol
IUPAC name11-(2,3-dihydroxypropoxy)undecanoic acid
InChIKeyABAGAKRGOFFKAC-UHFFFAOYSA-N
SMILESC(CCCCCOCC(CO)O)CCCCC(=O)O

Computed by PubChem (NCBI)