CAS 258353-77-4 is the registry number for Octyl a-L-rhamnopyranoside. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
(2S,3R,4R,5R,6R)-2-methyl-6-octoxyoxane-3,4,5-triol (CAS 258353-77-4) is a chemical compound with the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. IUPAC name: (2S,3R,4R,5R,6R)-2-methyl-6-octoxyoxane-3,4,5-triol. InChIKey: ZIOKWRXTSUPEND-ODXJTPSBSA-N.
| Molecular formula | C14H28O5 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | (2S,3R,4R,5R,6R)-2-methyl-6-octoxyoxane-3,4,5-triol |
| InChIKey | ZIOKWRXTSUPEND-ODXJTPSBSA-N |
| SMILES | CCCCCCCCO[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O |
Computed by PubChem (NCBI)