CAS 113571-15-6 appears in our catalog under these names: 4,6-Dibromo-2,3-dichloroaniline, 4,6–Dibromo–2,3–dichloroaniline, 4,6-Dibromo-2,3-dichloroaniline 98+%, 4,6-Dibromo-2,3-dichloroaniline, 98+%, 98+%, 4,6-Dibromo-2,3-dichloroaniline, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 250g.
4,6-dibromo-2,3-dichloroaniline (CAS 113571-15-6) is a chemical compound with the molecular formula C6H3Br2Cl2N and a molecular weight of 319.81 g/mol. IUPAC name: 4,6-dibromo-2,3-dichloroaniline. InChIKey: IPWGDMQXLGFBLC-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2Cl2N |
|---|---|
| Molecular weight | 319.81 g/mol |
| IUPAC name | 4,6-dibromo-2,3-dichloroaniline |
| InChIKey | IPWGDMQXLGFBLC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)Cl)N)Br |
Computed by PubChem (NCBI)