Products 71642-17-6
CAS 71642-17-6 is the registry number for 2,6-Dibromo-3,4-dichloroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
2,6-dibromo-3,4-dichloroaniline (CAS 71642-17-6) is a chemical compound with the molecular formula C6H3Br2Cl2N and a molecular weight of 319.81 g/mol. IUPAC name: 2,6-dibromo-3,4-dichloroaniline. InChIKey: XVEDJCXLDJZAHI-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2Cl2N |
|---|---|
| Molecular weight | 319.81 g/mol |
| IUPAC name | 2,6-dibromo-3,4-dichloroaniline |
| InChIKey | XVEDJCXLDJZAHI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)N)Br)Cl)Cl |
Computed by PubChem (NCBI)