Products 113585-35-6
CAS 113585-35-6 appears in our catalog under these names: 5,5'-(Butane-1,4-diylbis(oxy))diisophthalic acid, 98%, 98%, 5,5'-(Butane-1,4-diylbis(oxy))diisophthalic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-[4-(3,5-dicarboxyphenoxy)butoxy]benzene-1,3-dicarboxylic acid (CAS 113585-35-6) is a chemical compound with the molecular formula C20H18O10 and a molecular weight of 418.3 g/mol. IUPAC name: 5-[4-(3,5-dicarboxyphenoxy)butoxy]benzene-1,3-dicarboxylic acid. InChIKey: WIYYHESYFXENJY-UHFFFAOYSA-N.
| Molecular formula | C20H18O10 |
|---|---|
| Molecular weight | 418.3 g/mol |
| IUPAC name | 5-[4-(3,5-dicarboxyphenoxy)butoxy]benzene-1,3-dicarboxylic acid |
| InChIKey | WIYYHESYFXENJY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)OCCCCOC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)