CAS 73536-69-3 appears in our catalog under these names: Bifendate, Bifendate, >95% (HPLC), Bifendate/ 100%, Bifendate, >98.0%(GC), Dimethyl 7,7'-dimethoxy-(4,4'-bibenzo(d)(1,3)dioxole)-5,5'-dicarboxylate. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, TCI. Available pack sizes: on request, 1g, 50mg, 100mg, 200mg, 5g, 25g, 250g.
Methyl 7-methoxy-4-(7-methoxy-5-methoxycarbonyl-1,3-benzodioxol-4-yl)-1,3-benzodioxole-5-carboxylate (CAS 73536-69-3) is a chemical compound with the molecular formula C20H18O10 and a molecular weight of 418.3 g/mol. IUPAC name: methyl 7-methoxy-4-(7-methoxy-5-methoxycarbonyl-1,3-benzodioxol-4-yl)-1,3-benzodioxole-5-carboxylate. InChIKey: JMZOMFYRADAWOG-UHFFFAOYSA-N.
| Molecular formula | C20H18O10 |
|---|---|
| Molecular weight | 418.3 g/mol |
| IUPAC name | methyl 7-methoxy-4-(7-methoxy-5-methoxycarbonyl-1,3-benzodioxol-4-yl)-1,3-benzodioxole-5-carboxylate |
| InChIKey | JMZOMFYRADAWOG-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C(=C1)C(=O)OC)C3=C4C(=C(C=C3C(=O)OC)OC)OCO4)OCO2 |
Computed by PubChem (NCBI)