Products 113591-52-9

CAS 113591-52-9 is the registry number for 3-(6-Methoxy-naphthalen-2-yl)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(6-methoxynaphthalen-2-yl)-2-methylpropanoic acid (CAS 113591-52-9) is a chemical compound with the molecular formula C15H16O3 and a molecular weight of 244.28 g/mol. IUPAC name: 3-(6-methoxynaphthalen-2-yl)-2-methylpropanoic acid. InChIKey: IEXRXFDCDLEDGZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16O3
Molecular weight244.28 g/mol
IUPAC name3-(6-methoxynaphthalen-2-yl)-2-methylpropanoic acid
InChIKeyIEXRXFDCDLEDGZ-UHFFFAOYSA-N
SMILESCC(CC1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O

Computed by PubChem (NCBI)