CAS 212757-12-5 appears in our catalog under these names: Diendo-3-benzoyl-bicyclo[2.2.1]heptane-2-carboxylic acid, 95%, Diendo-3-benzoyl-bicyclo(2.2.1)heptane-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(1S,2S,3R,4R)-3-benzoylbicyclo[2.2.1]heptane-2-carboxylic acid (CAS 212757-12-5) is a chemical compound with the molecular formula C15H16O3 and a molecular weight of 244.28 g/mol. IUPAC name: (1S,2S,3R,4R)-3-benzoylbicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: GGRGOXDLLVXREZ-XQHKEYJVSA-N.
| Molecular formula | C15H16O3 |
|---|---|
| Molecular weight | 244.28 g/mol |
| IUPAC name | (1S,2S,3R,4R)-3-benzoylbicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | GGRGOXDLLVXREZ-XQHKEYJVSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@H]([C@H]2C(=O)O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)