CAS 113626-33-8 is the registry number for 3,3'-Dithiobis-L-valine, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 2,5g, 250mg.
(2R)-2-amino-3-[[(1R)-1-amino-1-carboxy-2-methylpropan-2-yl]disulfanyl]-3-methylbutanoic acid (CAS 113626-33-8) is a chemical compound with the molecular formula C10H20N2O4S2 and a molecular weight of 296.4 g/mol. IUPAC name: (2R)-2-amino-3-[[(1R)-1-amino-1-carboxy-2-methylpropan-2-yl]disulfanyl]-3-methylbutanoic acid. InChIKey: POYPKGFSZHXASD-PHDIDXHHSA-N.
| Molecular formula | C10H20N2O4S2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (2R)-2-amino-3-[[(1R)-1-amino-1-carboxy-2-methylpropan-2-yl]disulfanyl]-3-methylbutanoic acid |
| InChIKey | POYPKGFSZHXASD-PHDIDXHHSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)N)SSC(C)(C)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)