Products 113705-27-4
CAS 113705-27-4 appears in our catalog under these names: 2,7-Diethynylnaphthalene, 98%, Naphthalene, 2,7-diethynyl-, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,7-diethynylnaphthalene (CAS 113705-27-4) is a chemical compound with the molecular formula C14H8 and a molecular weight of 176.21 g/mol. IUPAC name: 2,7-diethynylnaphthalene. InChIKey: ZRUQOHRBNUQTSY-UHFFFAOYSA-N.
| Molecular formula | C14H8 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2,7-diethynylnaphthalene |
| InChIKey | ZRUQOHRBNUQTSY-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)C=CC(=C2)C#C |
Computed by PubChem (NCBI)