Products 507276-82-6
CAS 507276-82-6 is the registry number for 2,6-Diethynylnaphthalene, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,6-diethynylnaphthalene (CAS 507276-82-6) is a chemical compound with the molecular formula C14H8 and a molecular weight of 176.21 g/mol. IUPAC name: 2,6-diethynylnaphthalene. InChIKey: DAWMSTQJPPKMKM-UHFFFAOYSA-N.
| Molecular formula | C14H8 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2,6-diethynylnaphthalene |
| InChIKey | DAWMSTQJPPKMKM-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)C=C(C=C2)C#C |
Computed by PubChem (NCBI)