CAS 113740-61-7 appears in our catalog under these names: Levocetirizine Hydrochloride Impurity LC-2, 2-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)acetic acid, 98%, Cetirizine Impurity B, 2-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)acetic acid, 98%, 98%. Offered by: Chemat Brand, AmBeed, Biosynth, Chemat. Available pack sizes: on request, 250mg, 1g, 0,25g, 2g, 5g, 10mg, 25mg.
2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid (CAS 113740-61-7) is a chemical compound with the molecular formula C19H21ClN2O2 and a molecular weight of 344.8 g/mol. IUPAC name: 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid. InChIKey: NBQBQRKLQXVPIS-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O2 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid |
| InChIKey | NBQBQRKLQXVPIS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)