CAS 942193-17-1 appears in our catalog under these names: Cetirizine Impurity 43, (R)-2-(4-((4-Chlorophenyl)(phenyl)methyl)piperazin-1-yl)acetic acid, 98%, (R)-De(carboxymethoxy) Cetirizine Acetic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid (CAS 942193-17-1) is a chemical compound with the molecular formula C19H21ClN2O2 and a molecular weight of 344.8 g/mol. IUPAC name: 2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid. InChIKey: NBQBQRKLQXVPIS-LJQANCHMSA-N.
| Molecular formula | C19H21ClN2O2 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | 2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]acetic acid |
| InChIKey | NBQBQRKLQXVPIS-LJQANCHMSA-N |
| SMILES | C1CN(CCN1CC(=O)O)[C@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)