CAS 113806-26-1 is the registry number for N-Benzylidene-L-alanine Sodium Salt. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
Sodium (2S)-2-(benzylideneamino)propanoate (CAS 113806-26-1) is a chemical compound with the molecular formula C10H10NNaO2 and a molecular weight of 199.18 g/mol. IUPAC name: sodium (2S)-2-(benzylideneamino)propanoate. InChIKey: UEYDEAGOZCQQKT-QRPNPIFTSA-M.
| Molecular formula | C10H10NNaO2 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | sodium (2S)-2-(benzylideneamino)propanoate |
| InChIKey | UEYDEAGOZCQQKT-QRPNPIFTSA-M |
| SMILES | C[C@@H](C(=O)[O-])N=CC1=CC=CC=C1.[Na+] |
Computed by PubChem (NCBI)