CAS 2973762-67-1 is the registry number for Sodium 2-(indolin-1-yl)acetate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Sodium 2-(2,3-dihydroindol-1-yl)acetate (CAS 2973762-67-1) is a chemical compound with the molecular formula C10H10NNaO2 and a molecular weight of 199.18 g/mol. IUPAC name: sodium 2-(2,3-dihydroindol-1-yl)acetate. InChIKey: AJLPCBGKMVCVDP-UHFFFAOYSA-M.
| Molecular formula | C10H10NNaO2 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | sodium 2-(2,3-dihydroindol-1-yl)acetate |
| InChIKey | AJLPCBGKMVCVDP-UHFFFAOYSA-M |
| SMILES | C1CN(C2=CC=CC=C21)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)