Products 113825-76-6
CAS 113825-76-6 appears in our catalog under these names: 7-Phenoxy-1,2,3,4,9,10-hexahydroacridin-9-one, 95%, 7-Phenoxy-1,2,3,4,9,10-hexahydroacridin-9-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
7-phenoxy-2,3,4,10-tetrahydro-1H-acridin-9-one (CAS 113825-76-6) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 7-phenoxy-2,3,4,10-tetrahydro-1H-acridin-9-one. InChIKey: RXKPXDOWWLSZHO-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 7-phenoxy-2,3,4,10-tetrahydro-1H-acridin-9-one |
| InChIKey | RXKPXDOWWLSZHO-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)C3=C(N2)C=CC(=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)