CAS 1138444-12-8 is the registry number for tert-Butyl 2,6-diiodopyridin-3-yl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl (2,6-diiodo-3-pyridinyl) carbonate (CAS 1138444-12-8) is a chemical compound with the molecular formula C10H11I2NO3 and a molecular weight of 447.01 g/mol. IUPAC name: tert-butyl (2,6-diiodo-3-pyridinyl) carbonate. InChIKey: OTQYIMVKIVIVNJ-UHFFFAOYSA-N.
| Molecular formula | C10H11I2NO3 |
|---|---|
| Molecular weight | 447.01 g/mol |
| IUPAC name | tert-butyl (2,6-diiodo-3-pyridinyl) carbonate |
| InChIKey | OTQYIMVKIVIVNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C(N=C(C=C1)I)I |
Computed by PubChem (NCBI)