Products 1138444-12-8

CAS 1138444-12-8 is the registry number for tert-Butyl 2,6-diiodopyridin-3-yl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl (2,6-diiodo-3-pyridinyl) carbonate (CAS 1138444-12-8) is a chemical compound with the molecular formula C10H11I2NO3 and a molecular weight of 447.01 g/mol. IUPAC name: tert-butyl (2,6-diiodo-3-pyridinyl) carbonate. InChIKey: OTQYIMVKIVIVNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11I2NO3
Molecular weight447.01 g/mol
IUPAC nametert-butyl (2,6-diiodo-3-pyridinyl) carbonate
InChIKeyOTQYIMVKIVIVNJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)OC1=C(N=C(C=C1)I)I

Computed by PubChem (NCBI)