Products 1186311-08-9

CAS 1186311-08-9 is the registry number for tert-Butyl 3,5-diiodopyridin-4-yl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl (3,5-diiodo-4-pyridinyl) carbonate (CAS 1186311-08-9) is a chemical compound with the molecular formula C10H11I2NO3 and a molecular weight of 447.01 g/mol. IUPAC name: tert-butyl (3,5-diiodo-4-pyridinyl) carbonate. InChIKey: AJSQVXIEJSVQID-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11I2NO3
Molecular weight447.01 g/mol
IUPAC nametert-butyl (3,5-diiodo-4-pyridinyl) carbonate
InChIKeyAJSQVXIEJSVQID-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)OC1=C(C=NC=C1I)I

Computed by PubChem (NCBI)