CAS 1138454-88-2 is the registry number for 5-Keto-2-methyl Isoborneol. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 25mg, 50mg, 100mg.
5-hydroxy-4,5,7,7-tetramethylbicyclo[2.2.1]heptan-2-one (CAS 1138454-88-2) is a chemical compound with the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. IUPAC name: 5-hydroxy-4,5,7,7-tetramethylbicyclo[2.2.1]heptan-2-one. InChIKey: WWCDYKJHABHQJH-UHFFFAOYSA-N.
| Molecular formula | C11H18O2 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | 5-hydroxy-4,5,7,7-tetramethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | WWCDYKJHABHQJH-UHFFFAOYSA-N |
| SMILES | CC1(C2CC(C1(CC2=O)C)(C)O)C |
Computed by PubChem (NCBI)