Products 1138454-88-2

CAS 1138454-88-2 is the registry number for 5-Keto-2-methyl Isoborneol. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

5-hydroxy-4,5,7,7-tetramethylbicyclo[2.2.1]heptan-2-one (CAS 1138454-88-2) is a chemical compound with the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. IUPAC name: 5-hydroxy-4,5,7,7-tetramethylbicyclo[2.2.1]heptan-2-one. InChIKey: WWCDYKJHABHQJH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O2
Molecular weight182.26 g/mol
IUPAC name5-hydroxy-4,5,7,7-tetramethylbicyclo[2.2.1]heptan-2-one
InChIKeyWWCDYKJHABHQJH-UHFFFAOYSA-N
SMILESCC1(C2CC(C1(CC2=O)C)(C)O)C

Computed by PubChem (NCBI)