CAS 113855-57-5 appears in our catalog under these names: 4-Iodonaphthalen-1-ol, 95%, 4-Iodonaphthalen-1-ol, >95%, >95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg.
4-iodonaphthalen-1-ol (CAS 113855-57-5) is a chemical compound with the molecular formula C10H7IO and a molecular weight of 270.07 g/mol. IUPAC name: 4-iodonaphthalen-1-ol. InChIKey: OETOATKYKFWHOL-UHFFFAOYSA-N.
| Molecular formula | C10H7IO |
|---|---|
| Molecular weight | 270.07 g/mol |
| IUPAC name | 4-iodonaphthalen-1-ol |
| InChIKey | OETOATKYKFWHOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2I)O |
Computed by PubChem (NCBI)